C15H19FN2O2 — CID 107114513
methyl 2-[(3-cyano-2-fluorophenyl)methylamino]-4-methylpentanoate (PubChem CID 107114513) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is methyl 2-[(3-cyano-2-fluorophenyl)methylamino]-4-methylpentanoate.
| Compound Name | methyl 2-[(3-cyano-2-fluorophenyl)methylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 107114513 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | methyl 2-[(3-cyano-2-fluorophenyl)methylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NCc1cccc(C#N)c1F |
| InChI | InChI=1S/C15H19FN2O2/c1-10(2)7-13(15(19)20-3)18-9-12-6-4-5-11(8-17)14(12)16/h4-6,10,13,18H,7,9H2,1-3H3 |
| InChIKey | YJSYDNKJGHXOET-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |