C14H10Cl2FNOS — CID 107116084
3-[(3,5-dichlorophenoxy)methyl]-2-fluorobenzenecarbothioamide (PubChem CID 107116084) has the molecular formula C14H10Cl2FNOS and a molecular weight of 330.21 g/mol. Its IUPAC name is 3-[(3,5-dichlorophenoxy)methyl]-2-fluorobenzenecarbothioamide.
| Compound Name | 3-[(3,5-dichlorophenoxy)methyl]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107116084 |
| Molecular Formula | C14H10Cl2FNOS |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 3-[(3,5-dichlorophenoxy)methyl]-2-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cccc(COc2cc(Cl)cc(Cl)c2)c1F |
| InChI | InChI=1S/C14H10Cl2FNOS/c15-9-4-10(16)6-11(5-9)19-7-8-2-1-3-12(13(8)17)14(18)20/h1-6H,7H2,(H2,18,20) |
| InChIKey | NVYABJXVSPSZCQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|