C17H14FNO2 — CID 107116256
2-fluoro-3-[(4-formyl-2,6-dimethylphenoxy)methyl]benzonitrile (PubChem CID 107116256) has the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. Its IUPAC name is 2-fluoro-3-[(4-formyl-2,6-dimethylphenoxy)methyl]benzonitrile.
| Compound Name | 2-fluoro-3-[(4-formyl-2,6-dimethylphenoxy)methyl]benzonitrile |
|---|---|
| PubChem CID | 107116256 |
| Molecular Formula | C17H14FNO2 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-fluoro-3-[(4-formyl-2,6-dimethylphenoxy)methyl]benzonitrile |
| SMILES | Cc1cc(C=O)cc(C)c1OCc1cccc(C#N)c1F |
| InChI | InChI=1S/C17H14FNO2/c1-11-6-13(9-20)7-12(2)17(11)21-10-15-5-3-4-14(8-19)16(15)18/h3-7,9H,10H2,1-2H3 |
| InChIKey | AUHNMUBMIRLOPR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|