C15H9Br3FNO — CID 107745776
3-[[2,6-dibromo-4-(bromomethyl)phenoxy]methyl]-2-fluorobenzonitrile (PubChem CID 107745776) has the molecular formula C15H9Br3FNO and a molecular weight of 477.95 g/mol. Its IUPAC name is 3-[[2,6-dibromo-4-(bromomethyl)phenoxy]methyl]-2-fluorobenzonitrile.
| Compound Name | 3-[[2,6-dibromo-4-(bromomethyl)phenoxy]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 107745776 |
| Molecular Formula | C15H9Br3FNO |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 474.82 |
| IUPAC Name | 3-[[2,6-dibromo-4-(bromomethyl)phenoxy]methyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cccc(COc2c(Br)cc(CBr)cc2Br)c1F |
| InChI | InChI=1S/C15H9Br3FNO/c16-6-9-4-12(17)15(13(18)5-9)21-8-11-3-1-2-10(7-20)14(11)19/h1-5H,6,8H2 |
| InChIKey | ODCAVRITYJYBNP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|