C16H14Br2N2O — CID 107741779
2-[[2,6-dibromo-4-(methylaminomethyl)phenoxy]methyl]benzonitrile (PubChem CID 107741779) has the molecular formula C16H14Br2N2O and a molecular weight of 410.11 g/mol. Its IUPAC name is 2-[[2,6-dibromo-4-(methylaminomethyl)phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-dibromo-4-(methylaminomethyl)phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 107741779 |
| Molecular Formula | C16H14Br2N2O |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | 2-[[2,6-dibromo-4-(methylaminomethyl)phenoxy]methyl]benzonitrile |
| SMILES | CNCc1cc(Br)c(OCc2ccccc2C#N)c(Br)c1 |
| InChI | InChI=1S/C16H14Br2N2O/c1-20-9-11-6-14(17)16(15(18)7-11)21-10-13-5-3-2-4-12(13)8-19/h2-7,20H,9-10H2,1H3 |
| InChIKey | FPEZZOFZAVAFCJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |