C15H24FN3O — CID 107117213
3-[[ethyl(2-methylbutyl)amino]methyl]-2-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 107117213) has the molecular formula C15H24FN3O and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-[[ethyl(2-methylbutyl)amino]methyl]-2-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[[ethyl(2-methylbutyl)amino]methyl]-2-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107117213 |
| Molecular Formula | C15H24FN3O |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 3-[[ethyl(2-methylbutyl)amino]methyl]-2-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | CCC(C)CN(CC)Cc1cccc(/C(N)=N/O)c1F |
| InChI | InChI=1S/C15H24FN3O/c1-4-11(3)9-19(5-2)10-12-7-6-8-13(14(12)16)15(17)18-20/h6-8,11,20H,4-5,9-10H2,1-3H3,(H2,17,18) |
| InChIKey | LIBRAVFBCAGNQS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|