C17H18FN3 — CID 107118550
3-[(3-amino-N-propylanilino)methyl]-2-fluorobenzonitrile (PubChem CID 107118550) has the molecular formula C17H18FN3 and a molecular weight of 283.35 g/mol. Its IUPAC name is 3-[(3-amino-N-propylanilino)methyl]-2-fluorobenzonitrile.
| Compound Name | 3-[(3-amino-N-propylanilino)methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 107118550 |
| Molecular Formula | C17H18FN3 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 3-[(3-amino-N-propylanilino)methyl]-2-fluorobenzonitrile |
| SMILES | CCCN(Cc1cccc(C#N)c1F)c1cccc(N)c1 |
| InChI | InChI=1S/C17H18FN3/c1-2-9-21(16-8-4-7-15(20)10-16)12-14-6-3-5-13(11-19)17(14)18/h3-8,10H,2,9,12,20H2,1H3 |
| InChIKey | SKAQDQDFKAYANY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|