C17H18BrN3 — CID 107281139
4-[(3-aminophenyl)methyl-propylamino]-2-bromobenzonitrile (PubChem CID 107281139) has the molecular formula C17H18BrN3 and a molecular weight of 344.26 g/mol. Its IUPAC name is 4-[(3-aminophenyl)methyl-propylamino]-2-bromobenzonitrile.
| Compound Name | 4-[(3-aminophenyl)methyl-propylamino]-2-bromobenzonitrile |
|---|---|
| PubChem CID | 107281139 |
| Molecular Formula | C17H18BrN3 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 4-[(3-aminophenyl)methyl-propylamino]-2-bromobenzonitrile |
| SMILES | CCCN(Cc1cccc(N)c1)c1ccc(C#N)c(Br)c1 |
| InChI | InChI=1S/C17H18BrN3/c1-2-8-21(12-13-4-3-5-15(20)9-13)16-7-6-14(11-19)17(18)10-16/h3-7,9-10H,2,8,12,20H2,1H3 |
| InChIKey | GZYOLZWSWXCQFT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|