C18H24O6 — CID 10711902
[(4S,4'aS,8'aS)-5',5',8'a-trimethyl-2,4'-dioxospiro[1,3-dioxolane-4,1'-4a,6,7,8-tetrahydronaphthalene]-2'-yl]methyl acetate (PubChem CID 10711902) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is [(4S,4'aS,8'aS)-5',5',8'a-trimethyl-2,4'-dioxospiro[1,3-dioxolane-4,1'-4a,6,7,8-tetrahydronaphthalene]-2'-yl]methyl acetate.
| Compound Name | [(4S,4'aS,8'aS)-5',5',8'a-trimethyl-2,4'-dioxospiro[1,3-dioxolane-4,1'-4a,6,7,8-tetrahydronaphthalene]-2'-yl]methyl acetate |
|---|---|
| PubChem CID | 10711902 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [(4S,4'aS,8'aS)-5',5',8'a-trimethyl-2,4'-dioxospiro[1,3-dioxolane-4,1'-4a,6,7,8-tetrahydronaphthalene]-2'-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CC(=O)[C@H]2C(C)(C)CCC[C@]2(C)[C@@]12COC(=O)O2 |
| InChI | InChI=1S/C18H24O6/c1-11(19)22-9-12-8-13(20)14-16(2,3)6-5-7-17(14,4)18(12)10-23-15(21)24-18/h8,14H,5-7,9-10H2,1-4H3/t14-,17-,18+/m0/s1 |
| InChIKey | NLKNGACIRWWZJQ-JCGIZDLHSA-N |
| XLogP | 2.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |