C10H7FN2O2S2 — CID 107119910
2-fluoro-3-(1,2,4-thiadiazol-5-ylsulfanylmethyl)benzoic acid (PubChem CID 107119910) has the molecular formula C10H7FN2O2S2 and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-fluoro-3-(1,2,4-thiadiazol-5-ylsulfanylmethyl)benzoic acid.
| Compound Name | 2-fluoro-3-(1,2,4-thiadiazol-5-ylsulfanylmethyl)benzoic acid |
|---|---|
| PubChem CID | 107119910 |
| Molecular Formula | C10H7FN2O2S2 |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 2-fluoro-3-(1,2,4-thiadiazol-5-ylsulfanylmethyl)benzoic acid |
| SMILES | O=C(O)c1cccc(CSc2ncns2)c1F |
| InChI | InChI=1S/C10H7FN2O2S2/c11-8-6(2-1-3-7(8)9(14)15)4-16-10-12-5-13-17-10/h1-3,5H,4H2,(H,14,15) |
| InChIKey | HOJYPILQJXEPDU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |