C17H15FO2S — CID 107119844
3-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)-2-fluorobenzoic acid (PubChem CID 107119844) has the molecular formula C17H15FO2S and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)-2-fluorobenzoic acid.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 107119844 |
| Molecular Formula | C17H15FO2S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cccc(CSc2ccc3c(c2)CCC3)c1F |
| InChI | InChI=1S/C17H15FO2S/c18-16-13(5-2-6-15(16)17(19)20)10-21-14-8-7-11-3-1-4-12(11)9-14/h2,5-9H,1,3-4,10H2,(H,19,20) |
| InChIKey | YUNFIRNGEPPVSV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |