C17H17NO2S — CID 104825716
2-amino-6-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)benzoic acid (PubChem CID 104825716) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-amino-6-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)benzoic acid.
| Compound Name | 2-amino-6-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)benzoic acid |
|---|---|
| PubChem CID | 104825716 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-amino-6-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)benzoic acid |
| SMILES | Nc1cccc(CSc2ccc3c(c2)CCC3)c1C(=O)O |
| InChI | InChI=1S/C17H17NO2S/c18-15-6-2-5-13(16(15)17(19)20)10-21-14-8-7-11-3-1-4-12(11)9-14/h2,5-9H,1,3-4,10,18H2,(H,19,20) |
| InChIKey | MGMJMNIPTPRMCA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|