C16H14FNO2S — CID 83207426
2-amino-6-(2,3-dihydro-1H-inden-5-ylsulfanyl)-3-fluorobenzoic acid (PubChem CID 83207426) has the molecular formula C16H14FNO2S and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-amino-6-(2,3-dihydro-1H-inden-5-ylsulfanyl)-3-fluorobenzoic acid.
| Compound Name | 2-amino-6-(2,3-dihydro-1H-inden-5-ylsulfanyl)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 83207426 |
| Molecular Formula | C16H14FNO2S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-amino-6-(2,3-dihydro-1H-inden-5-ylsulfanyl)-3-fluorobenzoic acid |
| SMILES | Nc1c(F)ccc(Sc2ccc3c(c2)CCC3)c1C(=O)O |
| InChI | InChI=1S/C16H14FNO2S/c17-12-6-7-13(14(15(12)18)16(19)20)21-11-5-4-9-2-1-3-10(9)8-11/h4-8H,1-3,18H2,(H,19,20) |
| InChIKey | HUKATPCZCCWZNQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|