C18H16N2S — CID 106948786
6-(2,3-dihydro-1H-inden-5-ylsulfanyl)isoquinolin-5-amine (PubChem CID 106948786) has the molecular formula C18H16N2S and a molecular weight of 292.41 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-5-ylsulfanyl)isoquinolin-5-amine.
| Compound Name | 6-(2,3-dihydro-1H-inden-5-ylsulfanyl)isoquinolin-5-amine |
|---|---|
| PubChem CID | 106948786 |
| Molecular Formula | C18H16N2S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 6-(2,3-dihydro-1H-inden-5-ylsulfanyl)isoquinolin-5-amine |
| SMILES | Nc1c(Sc2ccc3c(c2)CCC3)ccc2cnccc12 |
| InChI | InChI=1S/C18H16N2S/c19-18-16-8-9-20-11-14(16)5-7-17(18)21-15-6-4-12-2-1-3-13(12)10-15/h4-11H,1-3,19H2 |
| InChIKey | XYKMMCNSWFSITR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|