C12H11F2N3O4 — CID 107122468
(2,5-difluoro-3-nitrophenyl)-(4-hydroxyiminopiperidin-1-yl)methanone (PubChem CID 107122468) has the molecular formula C12H11F2N3O4 and a molecular weight of 299.23 g/mol. Its IUPAC name is (2,5-difluoro-3-nitrophenyl)-(4-hydroxyiminopiperidin-1-yl)methanone.
| Compound Name | (2,5-difluoro-3-nitrophenyl)-(4-hydroxyiminopiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 107122468 |
| Molecular Formula | C12H11F2N3O4 |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (2,5-difluoro-3-nitrophenyl)-(4-hydroxyiminopiperidin-1-yl)methanone |
| SMILES | O=C(c1cc(F)cc([N+](=O)[O-])c1F)N1CCC(=NO)CC1 |
| InChI | InChI=1S/C12H11F2N3O4/c13-7-5-9(11(14)10(6-7)17(20)21)12(18)16-3-1-8(15-19)2-4-16/h5-6,19H,1-4H2 |
| InChIKey | NUXVQNHFABASPG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|