C11H5ClF2N4O3 — CID 107123861
N-(6-chloropyrazin-2-yl)-2,5-difluoro-3-nitrobenzamide (PubChem CID 107123861) has the molecular formula C11H5ClF2N4O3 and a molecular weight of 314.64 g/mol. Its IUPAC name is N-(6-chloropyrazin-2-yl)-2,5-difluoro-3-nitrobenzamide.
| Compound Name | N-(6-chloropyrazin-2-yl)-2,5-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 107123861 |
| Molecular Formula | C11H5ClF2N4O3 |
| Molecular Weight | 314.64 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | N-(6-chloropyrazin-2-yl)-2,5-difluoro-3-nitrobenzamide |
| SMILES | O=C(Nc1cncc(Cl)n1)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C11H5ClF2N4O3/c12-8-3-15-4-9(16-8)17-11(19)6-1-5(13)2-7(10(6)14)18(20)21/h1-4H,(H,16,17,19) |
| InChIKey | YBBQCGZDOIUNSD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.64 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|