C13H13ClN2O3S — CID 107124340
methyl 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-methoxyanilino)acetate (PubChem CID 107124340) has the molecular formula C13H13ClN2O3S and a molecular weight of 312.78 g/mol. Its IUPAC name is methyl 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-methoxyanilino)acetate.
| Compound Name | methyl 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-methoxyanilino)acetate |
|---|---|
| PubChem CID | 107124340 |
| Molecular Formula | C13H13ClN2O3S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | methyl 2-(5-chloro-1,3-thiazol-2-yl)-2-(3-methoxyanilino)acetate |
| SMILES | COC(=O)C(Nc1cccc(OC)c1)c1ncc(Cl)s1 |
| InChI | InChI=1S/C13H13ClN2O3S/c1-18-9-5-3-4-8(6-9)16-11(13(17)19-2)12-15-7-10(14)20-12/h3-7,11,16H,1-2H3 |
| InChIKey | IYBBPNXIFWUELT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |