C12H10BrClN2O2S — CID 107124335
methyl 2-(4-bromoanilino)-2-(5-chloro-1,3-thiazol-2-yl)acetate (PubChem CID 107124335) has the molecular formula C12H10BrClN2O2S and a molecular weight of 361.65 g/mol. Its IUPAC name is methyl 2-(4-bromoanilino)-2-(5-chloro-1,3-thiazol-2-yl)acetate.
| Compound Name | methyl 2-(4-bromoanilino)-2-(5-chloro-1,3-thiazol-2-yl)acetate |
|---|---|
| PubChem CID | 107124335 |
| Molecular Formula | C12H10BrClN2O2S |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | methyl 2-(4-bromoanilino)-2-(5-chloro-1,3-thiazol-2-yl)acetate |
| SMILES | COC(=O)C(Nc1ccc(Br)cc1)c1ncc(Cl)s1 |
| InChI | InChI=1S/C12H10BrClN2O2S/c1-18-12(17)10(11-15-6-9(14)19-11)16-8-4-2-7(13)3-5-8/h2-6,10,16H,1H3 |
| InChIKey | GLBONDZSWLGJES-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |