C10H14ClN3O2S — CID 107124353
methyl 2-(5-chloro-1,3-thiazol-2-yl)-2-piperazin-1-ylacetate (PubChem CID 107124353) has the molecular formula C10H14ClN3O2S and a molecular weight of 275.76 g/mol. Its IUPAC name is methyl 2-(5-chloro-1,3-thiazol-2-yl)-2-piperazin-1-ylacetate.
| Compound Name | methyl 2-(5-chloro-1,3-thiazol-2-yl)-2-piperazin-1-ylacetate |
|---|---|
| PubChem CID | 107124353 |
| Molecular Formula | C10H14ClN3O2S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | methyl 2-(5-chloro-1,3-thiazol-2-yl)-2-piperazin-1-ylacetate |
| SMILES | COC(=O)C(c1ncc(Cl)s1)N1CCNCC1 |
| InChI | InChI=1S/C10H14ClN3O2S/c1-16-10(15)8(9-13-6-7(11)17-9)14-4-2-12-3-5-14/h6,8,12H,2-5H2,1H3 |
| InChIKey | LJTYTSJMFXRNBF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |