C9H14Cl2N2O2 — CID 92573483
methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate (PubChem CID 92573483) has the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.13 g/mol. Its IUPAC name is methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate.
| Compound Name | methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate |
|---|---|
| PubChem CID | 92573483 |
| Molecular Formula | C9H14Cl2N2O2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate |
| SMILES | COC(=O)[C@H](C=C(Cl)Cl)N1CCNCC1 |
| InChI | InChI=1S/C9H14Cl2N2O2/c1-15-9(14)7(6-8(10)11)13-4-2-12-3-5-13/h6-7,12H,2-5H2,1H3/t7-/m0/s1 |
| InChIKey | MWXDNQFGGIYWOB-ZETCQYMHSA-N |
| XLogP | 0.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |