methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate

C9H14Cl2N2O2 — CID 92573483

IUPACmethyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate
SMILESCOC(=O)[C@H](C=C(Cl)Cl)N1CCNCC1
InChIInChI=1S/C9H14Cl2N2O2/c1-15-9(14)7(6-8(10)11)13-4-2-12-3-5-13/h6-7,12H,2-5H2,1H3/t7-/m0/s1
InChIKeyMWXDNQFGGIYWOB-ZETCQYMHSA-N
MW253.13 g/mol
LogP0.75
Rot. Bonds3

About methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate

methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate (PubChem CID 92573483) has the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.13 g/mol. Its IUPAC name is methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate.

Molecular Properties

Compound Namemethyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate
PubChem CID92573483
Molecular FormulaC9H14Cl2N2O2
Molecular Weight253.13 g/mol
Exact Mass252.04
IUPAC Namemethyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate
SMILESCOC(=O)[C@H](C=C(Cl)Cl)N1CCNCC1
InChIInChI=1S/C9H14Cl2N2O2/c1-15-9(14)7(6-8(10)11)13-4-2-12-3-5-13/h6-7,12H,2-5H2,1H3/t7-/m0/s1
InChIKeyMWXDNQFGGIYWOB-ZETCQYMHSA-N
XLogP0.75
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.13
LogP ≤ 50.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate?
The IUPAC name of methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate (CID 92573483) is methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate.
What is the SMILES notation for methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate?
The canonical SMILES for methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate is COC(=O)[C@H](C=C(Cl)Cl)N1CCNCC1.
What is the InChIKey of methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate?
The InChIKey is MWXDNQFGGIYWOB-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H14Cl2N2O2/c1-15-9(14)7(6-8(10)11)13-4-2-12-3-5-13/h6-7,12H,2-5H2,1H3/t7-/m0/s1.
What are the key properties of methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate?
methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate has a molecular weight of 253.13 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-4,4-dichloro-2-piperazin-1-ylbut-3-enoate is sourced from PubChem (CID 92573483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).