C11H8Cl2N2O2S — CID 107124347
2-(4-chloroanilino)-2-(5-chloro-1,3-thiazol-2-yl)acetic acid (PubChem CID 107124347) has the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.17 g/mol. Its IUPAC name is 2-(4-chloroanilino)-2-(5-chloro-1,3-thiazol-2-yl)acetic acid.
| Compound Name | 2-(4-chloroanilino)-2-(5-chloro-1,3-thiazol-2-yl)acetic acid |
|---|---|
| PubChem CID | 107124347 |
| Molecular Formula | C11H8Cl2N2O2S |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 2-(4-chloroanilino)-2-(5-chloro-1,3-thiazol-2-yl)acetic acid |
| SMILES | O=C(O)C(Nc1ccc(Cl)cc1)c1ncc(Cl)s1 |
| InChI | InChI=1S/C11H8Cl2N2O2S/c12-6-1-3-7(4-2-6)15-9(11(16)17)10-14-5-8(13)18-10/h1-5,9,15H,(H,16,17) |
| InChIKey | FFXJAKCSUXTNRT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |