C6H5ClN2O3S — CID 107124398
2-(5-chloro-1,3-thiazol-2-yl)-2-formamidoacetic acid (PubChem CID 107124398) has the molecular formula C6H5ClN2O3S and a molecular weight of 220.64 g/mol. Its IUPAC name is 2-(5-chloro-1,3-thiazol-2-yl)-2-formamidoacetic acid.
| Compound Name | 2-(5-chloro-1,3-thiazol-2-yl)-2-formamidoacetic acid |
|---|---|
| PubChem CID | 107124398 |
| Molecular Formula | C6H5ClN2O3S |
| Molecular Weight | 220.64 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | 2-(5-chloro-1,3-thiazol-2-yl)-2-formamidoacetic acid |
| SMILES | O=CNC(C(=O)O)c1ncc(Cl)s1 |
| InChI | InChI=1S/C6H5ClN2O3S/c7-3-1-8-5(13-3)4(6(11)12)9-2-10/h1-2,4H,(H,9,10)(H,11,12) |
| InChIKey | CYQXNVCWONNQQR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.64 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|