2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid

C14H10ClF2NO2 — CID 60993908

IUPAC2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid
SMILESO=C(O)C(Nc1ccc(Cl)cc1)c1ccc(F)cc1F
InChIInChI=1S/C14H10ClF2NO2/c15-8-1-4-10(5-2-8)18-13(14(19)20)11-6-3-9(16)7-12(11)17/h1-7,13,18H,(H,19,20)
InChIKeyGPONPAWMMDFLFP-UHFFFAOYSA-N
MW297.69 g/mol
LogP3.86
Rot. Bonds4

About 2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid

2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid (PubChem CID 60993908) has the molecular formula C14H10ClF2NO2 and a molecular weight of 297.69 g/mol. Its IUPAC name is 2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid.

Molecular Properties

Compound Name2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid
PubChem CID60993908
Molecular FormulaC14H10ClF2NO2
Molecular Weight297.69 g/mol
Exact Mass297.04
IUPAC Name2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid
SMILESO=C(O)C(Nc1ccc(Cl)cc1)c1ccc(F)cc1F
InChIInChI=1S/C14H10ClF2NO2/c15-8-1-4-10(5-2-8)18-13(14(19)20)11-6-3-9(16)7-12(11)17/h1-7,13,18H,(H,19,20)
InChIKeyGPONPAWMMDFLFP-UHFFFAOYSA-N
XLogP3.86
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.69
LogP ≤ 53.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid?
The IUPAC name of 2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid (CID 60993908) is 2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid.
What is the SMILES notation for 2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid?
The canonical SMILES for 2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid is O=C(O)C(Nc1ccc(Cl)cc1)c1ccc(F)cc1F.
What is the InChIKey of 2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid?
The InChIKey is GPONPAWMMDFLFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClF2NO2/c15-8-1-4-10(5-2-8)18-13(14(19)20)11-6-3-9(16)7-12(11)17/h1-7,13,18H,(H,19,20).
What are the key properties of 2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid?
2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid has a molecular weight of 297.69 g/mol, XLogP of 3.86, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid is sourced from PubChem (CID 60993908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).