2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid

C14H11F2NO2 — CID 54889513

IUPAC2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid
SMILESO=C(O)C(Nc1ccc(F)cc1)c1ccccc1F
InChIInChI=1S/C14H11F2NO2/c15-9-5-7-10(8-6-9)17-13(14(18)19)11-3-1-2-4-12(11)16/h1-8,13,17H,(H,18,19)
InChIKeyDLNGSZLDLKAAAB-UHFFFAOYSA-N
MW263.24 g/mol
LogP3.20
Rot. Bonds4

About 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid

2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid (PubChem CID 54889513) has the molecular formula C14H11F2NO2 and a molecular weight of 263.24 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid.

Molecular Properties

Compound Name2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid
PubChem CID54889513
Molecular FormulaC14H11F2NO2
Molecular Weight263.24 g/mol
Exact Mass263.08
IUPAC Name2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid
SMILESO=C(O)C(Nc1ccc(F)cc1)c1ccccc1F
InChIInChI=1S/C14H11F2NO2/c15-9-5-7-10(8-6-9)17-13(14(18)19)11-3-1-2-4-12(11)16/h1-8,13,17H,(H,18,19)
InChIKeyDLNGSZLDLKAAAB-UHFFFAOYSA-N
XLogP3.20
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.24
LogP ≤ 53.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(2,4-difluorophenyl)-2-(4-fluoroanilino)acetic acid
CID 60992205
2-(3-fluoroanilino)-2-(2-fluorophenyl)acetic acid
CID 54890173
ethyl 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetate
CID 60992471
2-anilino-2-(2-fluorophenyl)acetyl chloride
CID 142788298
(2R)-2-anilino-2-(4-fluorophenyl)acetic acid
CID 28810428
2-(4-chloroanilino)-2-(2,4-difluorophenyl)acetic acid
CID 60993908
2-(4-chloroanilino)-2-(2-chlorophenyl)acetic acid
CID 54890414
(2R)-2-(4-chlorophenyl)-2-(4-fluoroanilino)acetic acid
CID 7152583
2-anilino-2-(4-bromo-2-fluorophenyl)acetic acid
CID 54890074
2-anilino-2-(4-fluoro-2-methylphenyl)acetic acid
CID 62136008
2-anilino-2-(5-fluoro-2-methylphenyl)acetic acid
CID 114075665
2-[4-(difluoromethyl)phenyl]-2-(4-fluoroanilino)acetic acid
CID 115524519

Frequently Asked Questions

What is the IUPAC name of 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid?
The IUPAC name of 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid (CID 54889513) is 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid.
What is the SMILES notation for 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid?
The canonical SMILES for 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid is O=C(O)C(Nc1ccc(F)cc1)c1ccccc1F.
What is the InChIKey of 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid?
The InChIKey is DLNGSZLDLKAAAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2NO2/c15-9-5-7-10(8-6-9)17-13(14(18)19)11-3-1-2-4-12(11)16/h1-8,13,17H,(H,18,19).
What are the key properties of 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid?
2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid has a molecular weight of 263.24 g/mol, XLogP of 3.20, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid is sourced from PubChem (CID 54889513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).