2-anilino-2-(2-fluorophenyl)acetyl chloride

C14H11ClFNO — CID 142788298

IUPAC2-anilino-2-(2-fluorophenyl)acetyl chloride
SMILESO=C(Cl)C(Nc1ccccc1)c1ccccc1F
InChIInChI=1S/C14H11ClFNO/c15-14(18)13(11-8-4-5-9-12(11)16)17-10-6-2-1-3-7-10/h1-9,13,17H
InChIKeyLFWAMSLWTXGEPX-UHFFFAOYSA-N
MW263.70 g/mol
LogP3.74
Rot. Bonds4

About 2-anilino-2-(2-fluorophenyl)acetyl chloride

2-anilino-2-(2-fluorophenyl)acetyl chloride (PubChem CID 142788298) has the molecular formula C14H11ClFNO and a molecular weight of 263.70 g/mol. Its IUPAC name is 2-anilino-2-(2-fluorophenyl)acetyl chloride.

Molecular Properties

Compound Name2-anilino-2-(2-fluorophenyl)acetyl chloride
PubChem CID142788298
Molecular FormulaC14H11ClFNO
Molecular Weight263.70 g/mol
Exact Mass263.05
IUPAC Name2-anilino-2-(2-fluorophenyl)acetyl chloride
SMILESO=C(Cl)C(Nc1ccccc1)c1ccccc1F
InChIInChI=1S/C14H11ClFNO/c15-14(18)13(11-8-4-5-9-12(11)16)17-10-6-2-1-3-7-10/h1-9,13,17H
InChIKeyLFWAMSLWTXGEPX-UHFFFAOYSA-N
XLogP3.74
TPSA29.10 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.70
LogP ≤ 53.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-anilino-2-(2-fluorophenyl)acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(4-fluoroanilino)-2-(2-fluorophenyl)acetic acid
CID 54889513
2-(3-fluoroanilino)-2-(2-fluorophenyl)acetic acid
CID 54890173
2-anilino-N-(2,6-dimethylphenyl)-2-(2-fluorophenyl)acetamide
CID 71729422
ethyl 2-(4-fluoroanilino)-2-(2-fluorophenyl)acetate
CID 60992471
2-anilino-2-(4-bromo-2-fluorophenyl)acetic acid
CID 54890074
2-anilino-2-(2,4-difluorophenyl)acetamide
CID 54889357
ethyl 2-anilino-2-(2,3-difluorophenyl)acetate
CID 63668266
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(2-fluorophenyl)acetate
CID 59401183
2-anilino-2-(3-chloro-2-fluorophenyl)acetamide
CID 114488080
methyl 2-anilino-2-(2,6-difluorophenyl)acetate
CID 60991084
methyl 2-(3-bromoanilino)-2-(2-fluorophenyl)acetate
CID 60992716
methyl (3S)-3-anilino-3-(2-fluorophenyl)-2,2-dimethylpropanoate
CID 102255570

Frequently Asked Questions

What is the IUPAC name of 2-anilino-2-(2-fluorophenyl)acetyl chloride?
The IUPAC name of 2-anilino-2-(2-fluorophenyl)acetyl chloride (CID 142788298) is 2-anilino-2-(2-fluorophenyl)acetyl chloride.
What is the SMILES notation for 2-anilino-2-(2-fluorophenyl)acetyl chloride?
The canonical SMILES for 2-anilino-2-(2-fluorophenyl)acetyl chloride is O=C(Cl)C(Nc1ccccc1)c1ccccc1F.
What is the InChIKey of 2-anilino-2-(2-fluorophenyl)acetyl chloride?
The InChIKey is LFWAMSLWTXGEPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClFNO/c15-14(18)13(11-8-4-5-9-12(11)16)17-10-6-2-1-3-7-10/h1-9,13,17H.
What are the key properties of 2-anilino-2-(2-fluorophenyl)acetyl chloride?
2-anilino-2-(2-fluorophenyl)acetyl chloride has a molecular weight of 263.70 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-2-(2-fluorophenyl)acetyl chloride is sourced from PubChem (CID 142788298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).