C15H15Cl2NO4 — CID 10712445
[(3aS,4R,6R,6aS)-3-(2,6-dichlorophenyl)-6-hydroxy-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-yl] acetate (PubChem CID 10712445) has the molecular formula C15H15Cl2NO4 and a molecular weight of 344.19 g/mol. Its IUPAC name is [(3aS,4R,6R,6aS)-3-(2,6-dichlorophenyl)-6-hydroxy-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-yl] acetate.
| Compound Name | [(3aS,4R,6R,6aS)-3-(2,6-dichlorophenyl)-6-hydroxy-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-yl] acetate |
|---|---|
| PubChem CID | 10712445 |
| Molecular Formula | C15H15Cl2NO4 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | [(3aS,4R,6R,6aS)-3-(2,6-dichlorophenyl)-6-hydroxy-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@](C)(O)[C@H]2ON=C(c3c(Cl)cccc3Cl)[C@@H]12 |
| InChI | InChI=1S/C15H15Cl2NO4/c1-7(19)21-10-6-15(2,20)14-12(10)13(18-22-14)11-8(16)4-3-5-9(11)17/h3-5,10,12,14,20H,6H2,1-2H3/t10-,12-,14+,15-/m1/s1 |
| InChIKey | YSQWNMYXBHBHPM-WAZAZEMKSA-N |
| XLogP | 2.80 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |