C13H13Cl2NO2 — CID 10334159
(3aR,6R,6aS)-3-(2,6-dichlorophenyl)-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazol-6-ol (PubChem CID 10334159) has the molecular formula C13H13Cl2NO2 and a molecular weight of 286.16 g/mol. Its IUPAC name is (3aR,6R,6aS)-3-(2,6-dichlorophenyl)-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazol-6-ol.
| Compound Name | (3aR,6R,6aS)-3-(2,6-dichlorophenyl)-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazol-6-ol |
|---|---|
| PubChem CID | 10334159 |
| Molecular Formula | C13H13Cl2NO2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | (3aR,6R,6aS)-3-(2,6-dichlorophenyl)-6-methyl-3a,4,5,6a-tetrahydrocyclopenta[d][1,2]oxazol-6-ol |
| SMILES | C[C@@]1(O)CC[C@@H]2C(c3c(Cl)cccc3Cl)=NO[C@@H]21 |
| InChI | InChI=1S/C13H13Cl2NO2/c1-13(17)6-5-7-11(16-18-12(7)13)10-8(14)3-2-4-9(10)15/h2-4,7,12,17H,5-6H2,1H3/t7-,12+,13-/m1/s1 |
| InChIKey | JADPJVVJBNRSHH-HYJLZEBJSA-N |
| XLogP | 3.26 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |