C12H9Cl2NO3 — CID 10613171
(3aR,6S,6aS)-3-(2,6-dichlorophenyl)-6-hydroxy-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-one (PubChem CID 10613171) has the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. Its IUPAC name is (3aR,6S,6aS)-3-(2,6-dichlorophenyl)-6-hydroxy-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-one.
| Compound Name | (3aR,6S,6aS)-3-(2,6-dichlorophenyl)-6-hydroxy-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 10613171 |
| Molecular Formula | C12H9Cl2NO3 |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | (3aR,6S,6aS)-3-(2,6-dichlorophenyl)-6-hydroxy-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-one |
| SMILES | O=C1C[C@H](O)[C@H]2ON=C(c3c(Cl)cccc3Cl)[C@@H]12 |
| InChI | InChI=1S/C12H9Cl2NO3/c13-5-2-1-3-6(14)9(5)11-10-7(16)4-8(17)12(10)18-15-11/h1-3,8,10,12,17H,4H2/t8-,10+,12+/m0/s1 |
| InChIKey | OPNBBESZLXLYLE-MKPLZMMCSA-N |
| XLogP | 2.05 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |