C13H11Cl2NO2 — CID 10564962
(3aR,6S,6aR)-3-(2,6-dichlorophenyl)-6-methyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-one (PubChem CID 10564962) has the molecular formula C13H11Cl2NO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is (3aR,6S,6aR)-3-(2,6-dichlorophenyl)-6-methyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-one.
| Compound Name | (3aR,6S,6aR)-3-(2,6-dichlorophenyl)-6-methyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 10564962 |
| Molecular Formula | C13H11Cl2NO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | (3aR,6S,6aR)-3-(2,6-dichlorophenyl)-6-methyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-4-one |
| SMILES | C[C@H]1CC(=O)[C@@H]2C(c3c(Cl)cccc3Cl)=NO[C@@H]21 |
| InChI | InChI=1S/C13H11Cl2NO2/c1-6-5-9(17)11-12(16-18-13(6)11)10-7(14)3-2-4-8(10)15/h2-4,6,11,13H,5H2,1H3/t6-,11+,13+/m0/s1 |
| InChIKey | VWFMXRAFGZGTQH-LFNPPYNTSA-N |
| XLogP | 3.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |