C14H11Cl2NO4 — CID 10496486
[(3aR,6S,6aS)-3-(2,6-dichlorophenyl)-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-6-yl] acetate (PubChem CID 10496486) has the molecular formula C14H11Cl2NO4 and a molecular weight of 328.15 g/mol. Its IUPAC name is [(3aR,6S,6aS)-3-(2,6-dichlorophenyl)-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-6-yl] acetate.
| Compound Name | [(3aR,6S,6aS)-3-(2,6-dichlorophenyl)-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-6-yl] acetate |
|---|---|
| PubChem CID | 10496486 |
| Molecular Formula | C14H11Cl2NO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | [(3aR,6S,6aS)-3-(2,6-dichlorophenyl)-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazol-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)[C@@H]2C(c3c(Cl)cccc3Cl)=NO[C@@H]21 |
| InChI | InChI=1S/C14H11Cl2NO4/c1-6(18)20-10-5-9(19)12-13(17-21-14(10)12)11-7(15)3-2-4-8(11)16/h2-4,10,12,14H,5H2,1H3/t10-,12+,14+/m0/s1 |
| InChIKey | HKMIZHGVKNYEJO-ZKYQVNSYSA-N |
| XLogP | 2.62 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |