C10H9ClN2OS — CID 107124874
1-(5-chloro-1,3-thiazol-2-yl)-2-pyridin-3-ylethanol (PubChem CID 107124874) has the molecular formula C10H9ClN2OS and a molecular weight of 240.72 g/mol. Its IUPAC name is 1-(5-chloro-1,3-thiazol-2-yl)-2-pyridin-3-ylethanol.
| Compound Name | 1-(5-chloro-1,3-thiazol-2-yl)-2-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 107124874 |
| Molecular Formula | C10H9ClN2OS |
| Molecular Weight | 240.72 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 1-(5-chloro-1,3-thiazol-2-yl)-2-pyridin-3-ylethanol |
| SMILES | OC(Cc1cccnc1)c1ncc(Cl)s1 |
| InChI | InChI=1S/C10H9ClN2OS/c11-9-6-13-10(15-9)8(14)4-7-2-1-3-12-5-7/h1-3,5-6,8,14H,4H2 |
| InChIKey | LMLYHECFQKCMAK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.72 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |