C13H14ClNO2S — CID 107124967
(5-chloro-1,3-thiazol-2-yl)-(4-propoxyphenyl)methanol (PubChem CID 107124967) has the molecular formula C13H14ClNO2S and a molecular weight of 283.78 g/mol. Its IUPAC name is (5-chloro-1,3-thiazol-2-yl)-(4-propoxyphenyl)methanol.
| Compound Name | (5-chloro-1,3-thiazol-2-yl)-(4-propoxyphenyl)methanol |
|---|---|
| PubChem CID | 107124967 |
| Molecular Formula | C13H14ClNO2S |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | (5-chloro-1,3-thiazol-2-yl)-(4-propoxyphenyl)methanol |
| SMILES | CCCOc1ccc(C(O)c2ncc(Cl)s2)cc1 |
| InChI | InChI=1S/C13H14ClNO2S/c1-2-7-17-10-5-3-9(4-6-10)12(16)13-15-8-11(14)18-13/h3-6,8,12,16H,2,7H2,1H3 |
| InChIKey | AJHWVXNKTYECOJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |