C14H14ClN3OS — CID 107125122
1-(5-chloro-1,3-thiazol-2-yl)-2-(1-ethylbenzimidazol-2-yl)ethanol (PubChem CID 107125122) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is 1-(5-chloro-1,3-thiazol-2-yl)-2-(1-ethylbenzimidazol-2-yl)ethanol.
| Compound Name | 1-(5-chloro-1,3-thiazol-2-yl)-2-(1-ethylbenzimidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 107125122 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-(5-chloro-1,3-thiazol-2-yl)-2-(1-ethylbenzimidazol-2-yl)ethanol |
| SMILES | CCn1c(CC(O)c2ncc(Cl)s2)nc2ccccc21 |
| InChI | InChI=1S/C14H14ClN3OS/c1-2-18-10-6-4-3-5-9(10)17-13(18)7-11(19)14-16-8-12(15)20-14/h3-6,8,11,19H,2,7H2,1H3 |
| InChIKey | JNFODVKTARAQQU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |