C16H34O4Si2 — CID 10712635
1,4-bis[[tert-butyl(dimethyl)silyl]oxy]butane-2,3-dione (PubChem CID 10712635) has the molecular formula C16H34O4Si2 and a molecular weight of 346.62 g/mol. Its IUPAC name is 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]butane-2,3-dione.
| Compound Name | 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]butane-2,3-dione |
|---|---|
| PubChem CID | 10712635 |
| Molecular Formula | C16H34O4Si2 |
| Molecular Weight | 346.62 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]butane-2,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCC(=O)C(=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O4Si2/c1-15(2,3)21(7,8)19-11-13(17)14(18)12-20-22(9,10)16(4,5)6/h11-12H2,1-10H3 |
| InChIKey | AGDYDVGRBPPCLD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|