C25H56O4Si3 — CID 102264915
1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-tri(propan-2-yl)silyloxybutan-2-one (PubChem CID 102264915) has the molecular formula C25H56O4Si3 and a molecular weight of 504.98 g/mol. Its IUPAC name is 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-tri(propan-2-yl)silyloxybutan-2-one.
| Compound Name | 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-tri(propan-2-yl)silyloxybutan-2-one |
|---|---|
| PubChem CID | 102264915 |
| Molecular Formula | C25H56O4Si3 |
| Molecular Weight | 504.98 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-tri(propan-2-yl)silyloxybutan-2-one |
| SMILES | CC(C)[Si](OC(CO[Si](C)(C)C(C)(C)C)C(=O)CO[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H56O4Si3/c1-19(2)32(20(3)4,21(5)6)29-23(18-28-31(15,16)25(10,11)12)22(26)17-27-30(13,14)24(7,8)9/h19-21,23H,17-18H2,1-16H3 |
| InChIKey | MXAAOFNCYXBEIC-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.98 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|