C18H38O4Si2 — CID 15098271
(3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hexane-2,5-dione (PubChem CID 15098271) has the molecular formula C18H38O4Si2 and a molecular weight of 374.67 g/mol. Its IUPAC name is (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hexane-2,5-dione.
| Compound Name | (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hexane-2,5-dione |
|---|---|
| PubChem CID | 15098271 |
| Molecular Formula | C18H38O4Si2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hexane-2,5-dione |
| SMILES | CC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C18H38O4Si2/c1-13(19)15(21-23(9,10)17(3,4)5)16(14(2)20)22-24(11,12)18(6,7)8/h15-16H,1-12H3/t15-,16-/m0/s1 |
| InChIKey | HKAXWBPADRKBHQ-HOTGVXAUSA-N |
| XLogP | 4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|