C21H48O4Si3 — CID 615637
[tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propanoate (PubChem CID 615637) has the molecular formula C21H48O4Si3 and a molecular weight of 448.87 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propanoate |
|---|---|
| PubChem CID | 615637 |
| Molecular Formula | C21H48O4Si3 |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propanoate |
| SMILES | CC(C)(C)[Si](C)(C)OCC(O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H48O4Si3/c1-19(2,3)26(10,11)23-16-17(24-27(12,13)20(4,5)6)18(22)25-28(14,15)21(7,8)9/h17H,16H2,1-15H3 |
| InChIKey | SWGJEYHUUVBQIP-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|