C14H16N2O — CID 107126680
N-(2-cyanoethyl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 107126680) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is N-(2-cyanoethyl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-(2-cyanoethyl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 107126680 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-(2-cyanoethyl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | N#CCCNC(=O)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C14H16N2O/c15-8-3-9-16-14(17)13-7-6-11-4-1-2-5-12(11)10-13/h1-2,4-5,13H,3,6-7,9-10H2,(H,16,17) |
| InChIKey | KBRCJHKJSDBBTJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|