C16H24N2O2 — CID 107127313
N-[2-(2-hydroxypropylamino)ethyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 107127313) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[2-(2-hydroxypropylamino)ethyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[2-(2-hydroxypropylamino)ethyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 107127313 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-[2-(2-hydroxypropylamino)ethyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | CC(O)CNCCNC(=O)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H24N2O2/c1-12(19)11-17-8-9-18-16(20)15-7-6-13-4-2-3-5-14(13)10-15/h2-5,12,15,17,19H,6-11H2,1H3,(H,18,20) |
| InChIKey | HINBCNVVJGQNRX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|