C16H15FN2O — CID 107127954
N-(6-fluoro-2-pyridinyl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 107127954) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is N-(6-fluoro-2-pyridinyl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-(6-fluoro-2-pyridinyl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 107127954 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-(6-fluoro-2-pyridinyl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(Nc1cccc(F)n1)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H15FN2O/c17-14-6-3-7-15(18-14)19-16(20)13-9-8-11-4-1-2-5-12(11)10-13/h1-7,13H,8-10H2,(H,18,19,20) |
| InChIKey | UVAOZBAYKMIXKG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|