C17H17FO — CID 107128521
2,3-dihydro-1H-inden-2-yl-(3-fluoro-4-methylphenyl)methanol (PubChem CID 107128521) has the molecular formula C17H17FO and a molecular weight of 256.32 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl-(3-fluoro-4-methylphenyl)methanol.
| Compound Name | 2,3-dihydro-1H-inden-2-yl-(3-fluoro-4-methylphenyl)methanol |
|---|---|
| PubChem CID | 107128521 |
| Molecular Formula | C17H17FO |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl-(3-fluoro-4-methylphenyl)methanol |
| SMILES | Cc1ccc(C(O)C2Cc3ccccc3C2)cc1F |
| InChI | InChI=1S/C17H17FO/c1-11-6-7-14(10-16(11)18)17(19)15-8-12-4-2-3-5-13(12)9-15/h2-7,10,15,17,19H,8-9H2,1H3 |
| InChIKey | ZRODDUWBIGUXOP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |