C15H21FO — CID 107128518
(3-ethylcyclopentyl)-(3-fluoro-4-methylphenyl)methanol (PubChem CID 107128518) has the molecular formula C15H21FO and a molecular weight of 236.33 g/mol. Its IUPAC name is (3-ethylcyclopentyl)-(3-fluoro-4-methylphenyl)methanol.
| Compound Name | (3-ethylcyclopentyl)-(3-fluoro-4-methylphenyl)methanol |
|---|---|
| PubChem CID | 107128518 |
| Molecular Formula | C15H21FO |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (3-ethylcyclopentyl)-(3-fluoro-4-methylphenyl)methanol |
| SMILES | CCC1CCC(C(O)c2ccc(C)c(F)c2)C1 |
| InChI | InChI=1S/C15H21FO/c1-3-11-5-7-12(8-11)15(17)13-6-4-10(2)14(16)9-13/h4,6,9,11-12,15,17H,3,5,7-8H2,1-2H3 |
| InChIKey | GQOXIMIAPYWGOD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |