C11H15FO — CID 107129475
3-(3-fluoro-4-methylphenyl)-2-methylpropan-1-ol (PubChem CID 107129475) has the molecular formula C11H15FO and a molecular weight of 182.24 g/mol. Its IUPAC name is 3-(3-fluoro-4-methylphenyl)-2-methylpropan-1-ol.
| Compound Name | 3-(3-fluoro-4-methylphenyl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 107129475 |
| Molecular Formula | C11H15FO |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-(3-fluoro-4-methylphenyl)-2-methylpropan-1-ol |
| SMILES | Cc1ccc(CC(C)CO)cc1F |
| InChI | InChI=1S/C11H15FO/c1-8(7-13)5-10-4-3-9(2)11(12)6-10/h3-4,6,8,13H,5,7H2,1-2H3 |
| InChIKey | OXIUTJDYTCSFIR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |