C16H20FNOS — CID 107130279
N-[(3-fluoro-4-methylphenyl)-(3-methoxythiophen-2-yl)methyl]propan-1-amine (PubChem CID 107130279) has the molecular formula C16H20FNOS and a molecular weight of 293.41 g/mol. Its IUPAC name is N-[(3-fluoro-4-methylphenyl)-(3-methoxythiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-fluoro-4-methylphenyl)-(3-methoxythiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107130279 |
| Molecular Formula | C16H20FNOS |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[(3-fluoro-4-methylphenyl)-(3-methoxythiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(C)c(F)c1)c1sccc1OC |
| InChI | InChI=1S/C16H20FNOS/c1-4-8-18-15(16-14(19-3)7-9-20-16)12-6-5-11(2)13(17)10-12/h5-7,9-10,15,18H,4,8H2,1-3H3 |
| InChIKey | FGGNRYKFTSKJPP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |