C14H16FNOS — CID 115792372
N-[(3-fluorophenyl)-(3-methoxythiophen-2-yl)methyl]ethanamine (PubChem CID 115792372) has the molecular formula C14H16FNOS and a molecular weight of 265.35 g/mol. Its IUPAC name is N-[(3-fluorophenyl)-(3-methoxythiophen-2-yl)methyl]ethanamine.
| Compound Name | N-[(3-fluorophenyl)-(3-methoxythiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 115792372 |
| Molecular Formula | C14H16FNOS |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-[(3-fluorophenyl)-(3-methoxythiophen-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(F)c1)c1sccc1OC |
| InChI | InChI=1S/C14H16FNOS/c1-3-16-13(10-5-4-6-11(15)9-10)14-12(17-2)7-8-18-14/h4-9,13,16H,3H2,1-2H3 |
| InChIKey | ATPRJPJJOVKQSV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |