C13H25NS — CID 107132224
2,2-dimethyl-N-(thiolan-3-ylmethyl)cyclohexan-1-amine (PubChem CID 107132224) has the molecular formula C13H25NS and a molecular weight of 227.42 g/mol. Its IUPAC name is 2,2-dimethyl-N-(thiolan-3-ylmethyl)cyclohexan-1-amine.
| Compound Name | 2,2-dimethyl-N-(thiolan-3-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 107132224 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 2,2-dimethyl-N-(thiolan-3-ylmethyl)cyclohexan-1-amine |
| SMILES | CC1(C)CCCCC1NCC1CCSC1 |
| InChI | InChI=1S/C13H25NS/c1-13(2)7-4-3-5-12(13)14-9-11-6-8-15-10-11/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | BGKYHMKKOILYQW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |