C15H27N — CID 79835364
N-(cyclohex-3-en-1-ylmethyl)-2,2-dimethylcyclohexan-1-amine (PubChem CID 79835364) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-2,2-dimethylcyclohexan-1-amine.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-2,2-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79835364 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-2,2-dimethylcyclohexan-1-amine |
| SMILES | CC1(C)CCCCC1NCC1CC=CCC1 |
| InChI | InChI=1S/C15H27N/c1-15(2)11-7-6-10-14(15)16-12-13-8-4-3-5-9-13/h3-4,13-14,16H,5-12H2,1-2H3 |
| InChIKey | NJRCHXJIPUFJEC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|