C12H14BrNO2S — CID 107133026
2-(2-bromoanilino)-2-(thiolan-3-yl)acetic acid (PubChem CID 107133026) has the molecular formula C12H14BrNO2S and a molecular weight of 316.22 g/mol. Its IUPAC name is 2-(2-bromoanilino)-2-(thiolan-3-yl)acetic acid.
| Compound Name | 2-(2-bromoanilino)-2-(thiolan-3-yl)acetic acid |
|---|---|
| PubChem CID | 107133026 |
| Molecular Formula | C12H14BrNO2S |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 2-(2-bromoanilino)-2-(thiolan-3-yl)acetic acid |
| SMILES | O=C(O)C(Nc1ccccc1Br)C1CCSC1 |
| InChI | InChI=1S/C12H14BrNO2S/c13-9-3-1-2-4-10(9)14-11(12(15)16)8-5-6-17-7-8/h1-4,8,11,14H,5-7H2,(H,15,16) |
| InChIKey | RIPCUVYRJNIFES-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |