2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid

C11H10BrCl2NO2 — CID 107791302

IUPAC2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid
SMILESO=C(O)C(Nc1ccc(Br)c(Cl)c1Cl)C1CC1
InChIInChI=1S/C11H10BrCl2NO2/c12-6-3-4-7(9(14)8(6)13)15-10(11(16)17)5-1-2-5/h3-5,10,15H,1-2H2,(H,16,17)
InChIKeyXARXDGQYTFNJBH-UHFFFAOYSA-N
MW339.02 g/mol
LogP4.03
Rot. Bonds4

About 2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid

2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid (PubChem CID 107791302) has the molecular formula C11H10BrCl2NO2 and a molecular weight of 339.02 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid.

Molecular Properties

Compound Name2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid
PubChem CID107791302
Molecular FormulaC11H10BrCl2NO2
Molecular Weight339.02 g/mol
Exact Mass336.93
IUPAC Name2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid
SMILESO=C(O)C(Nc1ccc(Br)c(Cl)c1Cl)C1CC1
InChIInChI=1S/C11H10BrCl2NO2/c12-6-3-4-7(9(14)8(6)13)15-10(11(16)17)5-1-2-5/h3-5,10,15H,1-2H2,(H,16,17)
InChIKeyXARXDGQYTFNJBH-UHFFFAOYSA-N
XLogP4.03
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.02
LogP ≤ 54.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid?
The IUPAC name of 2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid (CID 107791302) is 2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid.
What is the SMILES notation for 2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid?
The canonical SMILES for 2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid is O=C(O)C(Nc1ccc(Br)c(Cl)c1Cl)C1CC1.
What is the InChIKey of 2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid?
The InChIKey is XARXDGQYTFNJBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrCl2NO2/c12-6-3-4-7(9(14)8(6)13)15-10(11(16)17)5-1-2-5/h3-5,10,15H,1-2H2,(H,16,17).
What are the key properties of 2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid?
2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid has a molecular weight of 339.02 g/mol, XLogP of 4.03, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-2,3-dichloroanilino)-2-cyclopropylacetic acid is sourced from PubChem (CID 107791302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).