C11H12BrCl2NO2 — CID 114001638
4-(4-bromo-2,3-dichloroanilino)pentanoic acid (PubChem CID 114001638) has the molecular formula C11H12BrCl2NO2 and a molecular weight of 341.03 g/mol. Its IUPAC name is 4-(4-bromo-2,3-dichloroanilino)pentanoic acid.
| Compound Name | 4-(4-bromo-2,3-dichloroanilino)pentanoic acid |
|---|---|
| PubChem CID | 114001638 |
| Molecular Formula | C11H12BrCl2NO2 |
| Molecular Weight | 341.03 g/mol |
| Exact Mass | 338.94 |
| IUPAC Name | 4-(4-bromo-2,3-dichloroanilino)pentanoic acid |
| SMILES | CC(CCC(=O)O)Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C11H12BrCl2NO2/c1-6(2-5-9(16)17)15-8-4-3-7(12)10(13)11(8)14/h3-4,6,15H,2,5H2,1H3,(H,16,17) |
| InChIKey | CLSWENTWBLXFQE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.03 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|